C26H21NO2 — CID 175081010
4-[[4-(N-phenylanilino)phenyl]methyl]benzoic acid (PubChem CID 175081010) has the molecular formula C26H21NO2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[[4-(N-phenylanilino)phenyl]methyl]benzoic acid.
| Compound Name | 4-[[4-(N-phenylanilino)phenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 175081010 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[[4-(N-phenylanilino)phenyl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H21NO2/c28-26(29)22-15-11-20(12-16-22)19-21-13-17-25(18-14-21)27(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-18H,19H2,(H,28,29) |
| InChIKey | MXIGFJTXEWQHSV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |