C28H22O2 — CID 141311981
1,2-bis(4-benzylphenyl)ethane-1,2-dione (PubChem CID 141311981) has the molecular formula C28H22O2 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1,2-bis(4-benzylphenyl)ethane-1,2-dione.
| Compound Name | 1,2-bis(4-benzylphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 141311981 |
| Molecular Formula | C28H22O2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1,2-bis(4-benzylphenyl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1ccc(Cc2ccccc2)cc1)c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H22O2/c29-27(25-15-11-23(12-16-25)19-21-7-3-1-4-8-21)28(30)26-17-13-24(14-18-26)20-22-9-5-2-6-10-22/h1-18H,19-20H2 |
| InChIKey | NLRZPIBSTFKSMR-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|