2-(4-benzylphenyl)acetyl chloride

C15H13ClO — CID 18187385

IUPAC2-(4-benzylphenyl)acetyl chloride
SMILESO=C(Cl)Cc1ccc(Cc2ccccc2)cc1
InChIInChI=1S/C15H13ClO/c16-15(17)11-14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9H,10-11H2
InChIKeyLTVSXQPTAYKTSM-UHFFFAOYSA-N
MW244.72 g/mol
LogP3.59
Rot. Bonds4

About 2-(4-benzylphenyl)acetyl chloride

2-(4-benzylphenyl)acetyl chloride (PubChem CID 18187385) has the molecular formula C15H13ClO and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-(4-benzylphenyl)acetyl chloride.

Molecular Properties

Compound Name2-(4-benzylphenyl)acetyl chloride
PubChem CID18187385
Molecular FormulaC15H13ClO
Molecular Weight244.72 g/mol
Exact Mass244.07
IUPAC Name2-(4-benzylphenyl)acetyl chloride
SMILESO=C(Cl)Cc1ccc(Cc2ccccc2)cc1
InChIInChI=1S/C15H13ClO/c16-15(17)11-14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9H,10-11H2
InChIKeyLTVSXQPTAYKTSM-UHFFFAOYSA-N
XLogP3.59
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.72
LogP ≤ 53.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(4-benzylphenyl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-benzylphenyl)acetyl chloride?
The IUPAC name of 2-(4-benzylphenyl)acetyl chloride (CID 18187385) is 2-(4-benzylphenyl)acetyl chloride.
What is the SMILES notation for 2-(4-benzylphenyl)acetyl chloride?
The canonical SMILES for 2-(4-benzylphenyl)acetyl chloride is O=C(Cl)Cc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of 2-(4-benzylphenyl)acetyl chloride?
The InChIKey is LTVSXQPTAYKTSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClO/c16-15(17)11-14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9H,10-11H2.
What are the key properties of 2-(4-benzylphenyl)acetyl chloride?
2-(4-benzylphenyl)acetyl chloride has a molecular weight of 244.72 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzylphenyl)acetyl chloride is sourced from PubChem (CID 18187385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).