About 2-(4-benzylphenyl)acetyl chloride
2-(4-benzylphenyl)acetyl chloride (PubChem CID 18187385) has the molecular formula C15H13ClO
and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-(4-benzylphenyl)acetyl chloride.
Molecular Properties
| Compound Name | 2-(4-benzylphenyl)acetyl chloride |
| PubChem CID | 18187385 |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-(4-benzylphenyl)acetyl chloride |
| SMILES | O=C(Cl)Cc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C15H13ClO/c16-15(17)11-14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9H,10-11H2 |
| InChIKey | LTVSXQPTAYKTSM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-benzylphenyl)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-benzylphenyl)acetyl chloride?
The IUPAC name of 2-(4-benzylphenyl)acetyl chloride (CID 18187385) is 2-(4-benzylphenyl)acetyl chloride.
What is the SMILES notation for 2-(4-benzylphenyl)acetyl chloride?
The canonical SMILES for 2-(4-benzylphenyl)acetyl chloride is O=C(Cl)Cc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of 2-(4-benzylphenyl)acetyl chloride?
The InChIKey is LTVSXQPTAYKTSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClO/c16-15(17)11-14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9H,10-11H2.
What are the key properties of 2-(4-benzylphenyl)acetyl chloride?
2-(4-benzylphenyl)acetyl chloride has a molecular weight of 244.72 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzylphenyl)acetyl chloride is sourced from PubChem (CID 18187385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).