About 2-(4-phenylphenyl)acetyl chloride
2-(4-phenylphenyl)acetyl chloride (PubChem CID 11264727) has the molecular formula C14H11ClO
and a molecular weight of 230.69 g/mol. Its IUPAC name is 2-(4-phenylphenyl)acetyl chloride.
Molecular Properties
| Compound Name | 2-(4-phenylphenyl)acetyl chloride |
| PubChem CID | 11264727 |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-(4-phenylphenyl)acetyl chloride |
| SMILES | O=C(Cl)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H11ClO/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | HWTMLSYLXGLSDF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-phenylphenyl)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenylphenyl)acetyl chloride?
The IUPAC name of 2-(4-phenylphenyl)acetyl chloride (CID 11264727) is 2-(4-phenylphenyl)acetyl chloride.
What is the SMILES notation for 2-(4-phenylphenyl)acetyl chloride?
The canonical SMILES for 2-(4-phenylphenyl)acetyl chloride is O=C(Cl)Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2-(4-phenylphenyl)acetyl chloride?
The InChIKey is HWTMLSYLXGLSDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClO/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2.
What are the key properties of 2-(4-phenylphenyl)acetyl chloride?
2-(4-phenylphenyl)acetyl chloride has a molecular weight of 230.69 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenylphenyl)acetyl chloride is sourced from PubChem (CID 11264727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).