About 2-(4-aminophenyl)acetyl chloride;ethane
2-(4-aminophenyl)acetyl chloride;ethane (PubChem CID 143474750) has the molecular formula C10H14ClNO
and a molecular weight of 199.68 g/mol. Its IUPAC name is 2-(4-aminophenyl)acetyl chloride;ethane.
Molecular Properties
| Compound Name | 2-(4-aminophenyl)acetyl chloride;ethane |
| PubChem CID | 143474750 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(4-aminophenyl)acetyl chloride;ethane |
| SMILES | CC.Nc1ccc(CC(=O)Cl)cc1 |
| InChI | InChI=1S/C8H8ClNO.C2H6/c9-8(11)5-6-1-3-7(10)4-2-6;1-2/h1-4H,5,10H2;1-2H3 |
| InChIKey | NGOUEAJYSMAAID-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminophenyl)acetyl chloride;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminophenyl)acetyl chloride;ethane?
The IUPAC name of 2-(4-aminophenyl)acetyl chloride;ethane (CID 143474750) is 2-(4-aminophenyl)acetyl chloride;ethane.
What is the SMILES notation for 2-(4-aminophenyl)acetyl chloride;ethane?
The canonical SMILES for 2-(4-aminophenyl)acetyl chloride;ethane is CC.Nc1ccc(CC(=O)Cl)cc1.
What is the InChIKey of 2-(4-aminophenyl)acetyl chloride;ethane?
The InChIKey is NGOUEAJYSMAAID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO.C2H6/c9-8(11)5-6-1-3-7(10)4-2-6;1-2/h1-4H,5,10H2;1-2H3.
What are the key properties of 2-(4-aminophenyl)acetyl chloride;ethane?
2-(4-aminophenyl)acetyl chloride;ethane has a molecular weight of 199.68 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminophenyl)acetyl chloride;ethane is sourced from PubChem (CID 143474750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).