C11H15NO4 — CID 175478961
2-(4-aminophenyl)acetic acid;propanoic acid (PubChem CID 175478961) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-(4-aminophenyl)acetic acid;propanoic acid.
| Compound Name | 2-(4-aminophenyl)acetic acid;propanoic acid |
|---|---|
| PubChem CID | 175478961 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(4-aminophenyl)acetic acid;propanoic acid |
| SMILES | CCC(=O)O.Nc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C8H9NO2.C3H6O2/c9-7-3-1-6(2-4-7)5-8(10)11;1-2-3(4)5/h1-4H,5,9H2,(H,10,11);2H2,1H3,(H,4,5) |
| InChIKey | ZYQXNOCGUVZSDC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|