About acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one
acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one (PubChem CID 162004262) has the molecular formula C21H20ClNO2
and a molecular weight of 353.85 g/mol. Its IUPAC name is acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one.
Molecular Properties
| Compound Name | acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one |
| PubChem CID | 162004262 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one |
| SMILES | C#Cc1ccc(CC(C)=O)cc1.C#Cc1ccc(N)cc1.CC(=O)Cl |
| InChI | InChI=1S/C11H10O.C8H7N.C2H3ClO/c1-3-10-4-6-11(7-5-10)8-9(2)12;1-2-7-3-5-8(9)6-4-7;1-2(3)4/h1,4-7H,8H2,2H3;1,3-6H,9H2;1H3 |
| InChIKey | YSPQVGOVEQYYAL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one?
The IUPAC name of acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one (CID 162004262) is acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one.
What is the SMILES notation for acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one?
The canonical SMILES for acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one is C#Cc1ccc(CC(C)=O)cc1.C#Cc1ccc(N)cc1.CC(=O)Cl.
What is the InChIKey of acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one?
The InChIKey is YSPQVGOVEQYYAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O.C8H7N.C2H3ClO/c1-3-10-4-6-11(7-5-10)8-9(2)12;1-2-7-3-5-8(9)6-4-7;1-2(3)4/h1,4-7H,8H2,2H3;1,3-6H,9H2;1H3.
What are the key properties of acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one?
acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one has a molecular weight of 353.85 g/mol, XLogP of 3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl chloride;4-ethynylaniline;1-(4-ethynylphenyl)propan-2-one is sourced from PubChem (CID 162004262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).