C28H23NO2 — CID 89016777
[4-(N-(4-benzylphenyl)anilino)phenyl] prop-2-enoate (PubChem CID 89016777) has the molecular formula C28H23NO2 and a molecular weight of 405.50 g/mol. Its IUPAC name is [4-(N-(4-benzylphenyl)anilino)phenyl] prop-2-enoate.
| Compound Name | [4-(N-(4-benzylphenyl)anilino)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 89016777 |
| Molecular Formula | C28H23NO2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [4-(N-(4-benzylphenyl)anilino)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N(c2ccccc2)c2ccc(Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H23NO2/c1-2-28(30)31-27-19-17-26(18-20-27)29(24-11-7-4-8-12-24)25-15-13-23(14-16-25)21-22-9-5-3-6-10-22/h2-20H,1,21H2 |
| InChIKey | VNWVBUJFQGBHJA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|