C18H19NO2 — CID 145430713
[4-(N-propylanilino)phenyl] prop-2-enoate (PubChem CID 145430713) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is [4-(N-propylanilino)phenyl] prop-2-enoate.
| Compound Name | [4-(N-propylanilino)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 145430713 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | [4-(N-propylanilino)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N(CCC)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO2/c1-3-14-19(15-8-6-5-7-9-15)16-10-12-17(13-11-16)21-18(20)4-2/h4-13H,2-3,14H2,1H3 |
| InChIKey | ZMTJSDTZCPEJCD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|