C25H25NO2 — CID 88981889
[4-[N-(4-phenylbutan-2-yl)anilino]phenyl] prop-2-enoate (PubChem CID 88981889) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is [4-[N-(4-phenylbutan-2-yl)anilino]phenyl] prop-2-enoate.
| Compound Name | [4-[N-(4-phenylbutan-2-yl)anilino]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 88981889 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | [4-[N-(4-phenylbutan-2-yl)anilino]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N(c2ccccc2)C(C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO2/c1-3-25(27)28-24-18-16-23(17-19-24)26(22-12-8-5-9-13-22)20(2)14-15-21-10-6-4-7-11-21/h3-13,16-20H,1,14-15H2,2H3 |
| InChIKey | YXJJWPFXCZRUJM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|