C20H22O2 — CID 70189649
[4-[2-(4-propylphenyl)ethyl]phenyl] prop-2-enoate (PubChem CID 70189649) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is [4-[2-(4-propylphenyl)ethyl]phenyl] prop-2-enoate.
| Compound Name | [4-[2-(4-propylphenyl)ethyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 70189649 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [4-[2-(4-propylphenyl)ethyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(CCc2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C20H22O2/c1-3-5-16-6-8-17(9-7-16)10-11-18-12-14-19(15-13-18)22-20(21)4-2/h4,6-9,12-15H,2-3,5,10-11H2,1H3 |
| InChIKey | XUHGHWYLJTUINW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|