C23H20O6 — CID 126633239
[4-[2-[3,5-di(prop-2-enoyloxy)phenyl]ethyl]phenyl] prop-2-enoate (PubChem CID 126633239) has the molecular formula C23H20O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is [4-[2-[3,5-di(prop-2-enoyloxy)phenyl]ethyl]phenyl] prop-2-enoate.
| Compound Name | [4-[2-[3,5-di(prop-2-enoyloxy)phenyl]ethyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 126633239 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [4-[2-[3,5-di(prop-2-enoyloxy)phenyl]ethyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(CCc2cc(OC(=O)C=C)cc(OC(=O)C=C)c2)cc1 |
| InChI | InChI=1S/C23H20O6/c1-4-21(24)27-18-11-9-16(10-12-18)7-8-17-13-19(28-22(25)5-2)15-20(14-17)29-23(26)6-3/h4-6,9-15H,1-3,7-8H2 |
| InChIKey | MQJWAQBNFLHQPY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|