C29H28O4 — CID 121370026
[4-[2-[3-methyl-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl]ethyl]phenyl] prop-2-enoate (PubChem CID 121370026) has the molecular formula C29H28O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is [4-[2-[3-methyl-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl]ethyl]phenyl] prop-2-enoate.
| Compound Name | [4-[2-[3-methyl-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl]ethyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 121370026 |
| Molecular Formula | C29H28O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [4-[2-[3-methyl-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl]ethyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(CCc2ccc(CCc3ccc(OC(=O)C=C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C29H28O4/c1-4-28(30)32-26-16-10-22(11-17-26)6-7-24-9-15-25(21(3)20-24)14-8-23-12-18-27(19-13-23)33-29(31)5-2/h4-5,9-13,15-20H,1-2,6-8,14H2,3H3 |
| InChIKey | ZPIJVDIGYIZGED-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|