C30H30O4 — CID 89309005
[4-[2-[2-methyl-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl]ethyl]phenyl] 2-methylprop-2-enoate (PubChem CID 89309005) has the molecular formula C30H30O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is [4-[2-[2-methyl-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl]ethyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[2-methyl-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl]ethyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89309005 |
| Molecular Formula | C30H30O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | [4-[2-[2-methyl-4-[2-(4-prop-2-enoyloxyphenyl)ethyl]phenyl]ethyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(CCc2ccc(CCc3ccc(OC(=O)C(=C)C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C30H30O4/c1-5-29(31)33-27-16-10-23(11-17-27)6-7-25-9-15-26(22(4)20-25)14-8-24-12-18-28(19-13-24)34-30(32)21(2)3/h5,9-13,15-20H,1-2,6-8,14H2,3-4H3 |
| InChIKey | VRLUTSXBQIRFDZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|