C34H32O4 — CID 121370036
[4-[2-[4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethyl]naphthalen-1-yl]ethyl]phenyl] 2-methylprop-2-enoate (PubChem CID 121370036) has the molecular formula C34H32O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is [4-[2-[4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethyl]naphthalen-1-yl]ethyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethyl]naphthalen-1-yl]ethyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121370036 |
| Molecular Formula | C34H32O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [4-[2-[4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethyl]naphthalen-1-yl]ethyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(CCc2ccc(CCc3ccc(OC(=O)C(=C)C)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C34H32O4/c1-23(2)33(35)37-29-19-11-25(12-20-29)9-15-27-17-18-28(32-8-6-5-7-31(27)32)16-10-26-13-21-30(22-14-26)38-34(36)24(3)4/h5-8,11-14,17-22H,1,3,9-10,15-16H2,2,4H3 |
| InChIKey | WNPYNSQGKGGXIO-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|