C18H30O3Si2 — CID 153316400
[4-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]phenyl] 2-methylprop-2-enoate (PubChem CID 153316400) has the molecular formula C18H30O3Si2 and a molecular weight of 350.61 g/mol. Its IUPAC name is [4-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153316400 |
| Molecular Formula | C18H30O3Si2 |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [4-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(CCC[Si](C)(C)O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H30O3Si2/c1-15(2)18(19)20-17-12-10-16(11-13-17)9-8-14-23(6,7)21-22(3,4)5/h10-13H,1,8-9,14H2,2-7H3 |
| InChIKey | GHLGVWBVGDNEIC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|