C30H25NO4 — CID 59745963
[4-(4-phenyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl] propanoate (PubChem CID 59745963) has the molecular formula C30H25NO4 and a molecular weight of 463.53 g/mol. Its IUPAC name is [4-(4-phenyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl] propanoate.
| Compound Name | [4-(4-phenyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl] propanoate |
|---|---|
| PubChem CID | 59745963 |
| Molecular Formula | C30H25NO4 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | [4-(4-phenyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl] propanoate |
| SMILES | C=CC(=O)Oc1ccc(N(c2ccc(OC(=O)CC)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H25NO4/c1-3-29(32)34-27-18-14-25(15-19-27)31(26-16-20-28(21-17-26)35-30(33)4-2)24-12-10-23(11-13-24)22-8-6-5-7-9-22/h3,5-21H,1,4H2,2H3 |
| InChIKey | BJYWBGAGOCEAJN-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|