C49H43NO6 — CID 22089691
2-[4-[2-[4-(N-(4-benzylphenyl)anilino)phenyl]-1-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethenyl]phenoxy]ethyl prop-2-enoate (PubChem CID 22089691) has the molecular formula C49H43NO6 and a molecular weight of 741.88 g/mol. Its IUPAC name is 2-[4-[2-[4-(N-(4-benzylphenyl)anilino)phenyl]-1-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethenyl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[2-[4-(N-(4-benzylphenyl)anilino)phenyl]-1-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethenyl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 22089691 |
| Molecular Formula | C49H43NO6 |
| Molecular Weight | 741.88 g/mol |
| Exact Mass | 741.31 |
| IUPAC Name | 2-[4-[2-[4-(N-(4-benzylphenyl)anilino)phenyl]-1-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethenyl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(C(=Cc2ccc(N(c3ccccc3)c3ccc(Cc4ccccc4)cc3)cc2)c2ccc(OCCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C49H43NO6/c1-3-48(51)55-33-31-53-45-27-19-40(20-28-45)47(41-21-29-46(30-22-41)54-32-34-56-49(52)4-2)36-39-17-25-44(26-18-39)50(42-13-9-6-10-14-42)43-23-15-38(16-24-43)35-37-11-7-5-8-12-37/h3-30,36H,1-2,31-35H2 |
| InChIKey | KCFCDSUJROKNSZ-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.88 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|