C38H33NO2 — CID 135297284
[4-(N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino)phenyl]methyl prop-2-enoate (PubChem CID 135297284) has the molecular formula C38H33NO2 and a molecular weight of 535.69 g/mol. Its IUPAC name is [4-(N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino)phenyl]methyl prop-2-enoate.
| Compound Name | [4-(N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino)phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 135297284 |
| Molecular Formula | C38H33NO2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | [4-(N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino)phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(N(c2ccccc2)c2ccc(C=C(c3ccc(C)cc3)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H33NO2/c1-4-38(40)41-27-31-16-24-36(25-17-31)39(34-8-6-5-7-9-34)35-22-14-30(15-23-35)26-37(32-18-10-28(2)11-19-32)33-20-12-29(3)13-21-33/h4-26H,1,27H2,2-3H3 |
| InChIKey | TWCARNZUKRWLAR-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|