C39H35NO3 — CID 59615584
2-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-1-phenylethenyl]phenyl]ethyl 2-oxopropanoate (PubChem CID 59615584) has the molecular formula C39H35NO3 and a molecular weight of 565.71 g/mol. Its IUPAC name is 2-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-1-phenylethenyl]phenyl]ethyl 2-oxopropanoate.
| Compound Name | 2-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-1-phenylethenyl]phenyl]ethyl 2-oxopropanoate |
|---|---|
| PubChem CID | 59615584 |
| Molecular Formula | C39H35NO3 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 2-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-1-phenylethenyl]phenyl]ethyl 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OCCc1ccc(C(=Cc2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H35NO3/c1-28-9-19-35(20-10-28)40(36-21-11-29(2)12-22-36)37-23-15-32(16-24-37)27-38(33-7-5-4-6-8-33)34-17-13-31(14-18-34)25-26-43-39(42)30(3)41/h4-24,27H,25-26H2,1-3H3 |
| InChIKey | DMABKIXWJATZFF-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|