C31H25NO3 — CID 59935411
[4-(N-(4-benzoylphenyl)-4-ethenylanilino)phenyl]methyl prop-2-enoate (PubChem CID 59935411) has the molecular formula C31H25NO3 and a molecular weight of 459.55 g/mol. Its IUPAC name is [4-(N-(4-benzoylphenyl)-4-ethenylanilino)phenyl]methyl prop-2-enoate.
| Compound Name | [4-(N-(4-benzoylphenyl)-4-ethenylanilino)phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 59935411 |
| Molecular Formula | C31H25NO3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | [4-(N-(4-benzoylphenyl)-4-ethenylanilino)phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(N(c2ccc(C=C)cc2)c2ccc(C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H25NO3/c1-3-23-10-16-27(17-11-23)32(28-18-12-24(13-19-28)22-35-30(33)4-2)29-20-14-26(15-21-29)31(34)25-8-6-5-7-9-25/h3-21H,1-2,22H2 |
| InChIKey | UUYJZNAWTMJJAG-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|