C25H22N2O4 — CID 59935337
[4-[4-(prop-2-enoyloxymethyl)-N-pyridin-2-ylanilino]phenyl]methyl prop-2-enoate (PubChem CID 59935337) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is [4-[4-(prop-2-enoyloxymethyl)-N-pyridin-2-ylanilino]phenyl]methyl prop-2-enoate.
| Compound Name | [4-[4-(prop-2-enoyloxymethyl)-N-pyridin-2-ylanilino]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 59935337 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [4-[4-(prop-2-enoyloxymethyl)-N-pyridin-2-ylanilino]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(N(c2ccc(COC(=O)C=C)cc2)c2ccccn2)cc1 |
| InChI | InChI=1S/C25H22N2O4/c1-3-24(28)30-17-19-8-12-21(13-9-19)27(23-7-5-6-16-26-23)22-14-10-20(11-15-22)18-31-25(29)4-2/h3-16H,1-2,17-18H2 |
| InChIKey | UMKZKXZJIVOQNW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|