About benzyl prop-2-enoate;ethyl(trimethoxy)silane
benzyl prop-2-enoate;ethyl(trimethoxy)silane (PubChem CID 174910420) has the molecular formula C15H24O5Si
and a molecular weight of 312.44 g/mol. Its IUPAC name is benzyl prop-2-enoate;ethyl(trimethoxy)silane.
Molecular Properties
| Compound Name | benzyl prop-2-enoate;ethyl(trimethoxy)silane |
| PubChem CID | 174910420 |
| Molecular Formula | C15H24O5Si |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | benzyl prop-2-enoate;ethyl(trimethoxy)silane |
| SMILES | C=CC(=O)OCc1ccccc1.CC[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H10O2.C5H14O3Si/c1-2-10(11)12-8-9-6-4-3-5-7-9;1-5-9(6-2,7-3)8-4/h2-7H,1,8H2;5H2,1-4H3 |
| InChIKey | UITXKKXJVLTWLV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl prop-2-enoate;ethyl(trimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl prop-2-enoate;ethyl(trimethoxy)silane?
The IUPAC name of benzyl prop-2-enoate;ethyl(trimethoxy)silane (CID 174910420) is benzyl prop-2-enoate;ethyl(trimethoxy)silane.
What is the SMILES notation for benzyl prop-2-enoate;ethyl(trimethoxy)silane?
The canonical SMILES for benzyl prop-2-enoate;ethyl(trimethoxy)silane is C=CC(=O)OCc1ccccc1.CC[Si](OC)(OC)OC.
What is the InChIKey of benzyl prop-2-enoate;ethyl(trimethoxy)silane?
The InChIKey is UITXKKXJVLTWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.C5H14O3Si/c1-2-10(11)12-8-9-6-4-3-5-7-9;1-5-9(6-2,7-3)8-4/h2-7H,1,8H2;5H2,1-4H3.
What are the key properties of benzyl prop-2-enoate;ethyl(trimethoxy)silane?
benzyl prop-2-enoate;ethyl(trimethoxy)silane has a molecular weight of 312.44 g/mol, XLogP of 2.80, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl prop-2-enoate;ethyl(trimethoxy)silane is sourced from PubChem (CID 174910420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).