C23H42O8Si2 — CID 159399182
prop-1-ene;trimethoxy(2-phenylethyl)silane;3-trimethoxysilylpropyl prop-2-enoate (PubChem CID 159399182) has the molecular formula C23H42O8Si2 and a molecular weight of 502.75 g/mol. Its IUPAC name is prop-1-ene;trimethoxy(2-phenylethyl)silane;3-trimethoxysilylpropyl prop-2-enoate.
| Compound Name | prop-1-ene;trimethoxy(2-phenylethyl)silane;3-trimethoxysilylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 159399182 |
| Molecular Formula | C23H42O8Si2 |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | prop-1-ene;trimethoxy(2-phenylethyl)silane;3-trimethoxysilylpropyl prop-2-enoate |
| SMILES | C=CC.C=CC(=O)OCCC[Si](OC)(OC)OC.CO[Si](CCc1ccccc1)(OC)OC |
| InChI | InChI=1S/C11H18O3Si.C9H18O5Si.C3H6/c1-12-15(13-2,14-3)10-9-11-7-5-4-6-8-11;1-5-9(10)14-7-6-8-15(11-2,12-3)13-4;1-3-2/h4-8H,9-10H2,1-3H3;5H,1,6-8H2,2-4H3;3H,1H2,2H3 |
| InChIKey | LNCUEZLYZQTVKB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|