C9H21O9PSi — CID 174981814
phosphoric acid;3-trimethoxysilylpropyl prop-2-enoate (PubChem CID 174981814) has the molecular formula C9H21O9PSi and a molecular weight of 332.32 g/mol. Its IUPAC name is phosphoric acid;3-trimethoxysilylpropyl prop-2-enoate.
| Compound Name | phosphoric acid;3-trimethoxysilylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 174981814 |
| Molecular Formula | C9H21O9PSi |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | phosphoric acid;3-trimethoxysilylpropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](OC)(OC)OC.O=P(O)(O)O |
| InChI | InChI=1S/C9H18O5Si.H3O4P/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4;1-5(2,3)4/h5H,1,6-8H2,2-4H3;(H3,1,2,3,4) |
| InChIKey | VKNYLJWABPITIP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|