C26H22O4 — CID 71422704
bis[(4-ethenylphenyl)methyl] benzene-1,3-dicarboxylate (PubChem CID 71422704) has the molecular formula C26H22O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is bis[(4-ethenylphenyl)methyl] benzene-1,3-dicarboxylate.
| Compound Name | bis[(4-ethenylphenyl)methyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71422704 |
| Molecular Formula | C26H22O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | bis[(4-ethenylphenyl)methyl] benzene-1,3-dicarboxylate |
| SMILES | C=Cc1ccc(COC(=O)c2cccc(C(=O)OCc3ccc(C=C)cc3)c2)cc1 |
| InChI | InChI=1S/C26H22O4/c1-3-19-8-12-21(13-9-19)17-29-25(27)23-6-5-7-24(16-23)26(28)30-18-22-14-10-20(4-2)11-15-22/h3-16H,1-2,17-18H2 |
| InChIKey | ZQBULIOOIJXBAB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |