About (4-ethenylphenyl)methyl 4-azidobenzoate
(4-ethenylphenyl)methyl 4-azidobenzoate (PubChem CID 138593704) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 4-azidobenzoate.
Molecular Properties
| Compound Name | (4-ethenylphenyl)methyl 4-azidobenzoate |
| PubChem CID | 138593704 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (4-ethenylphenyl)methyl 4-azidobenzoate |
| SMILES | C=Cc1ccc(COC(=O)c2ccc(N=[N+]=[N-])cc2)cc1 |
| InChI | InChI=1S/C16H13N3O2/c1-2-12-3-5-13(6-4-12)11-21-16(20)14-7-9-15(10-8-14)18-19-17/h2-10H,1,11H2 |
| InChIKey | GLZIXYMSNVIWIK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenylphenyl)methyl 4-azidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenylphenyl)methyl 4-azidobenzoate?
The IUPAC name of (4-ethenylphenyl)methyl 4-azidobenzoate (CID 138593704) is (4-ethenylphenyl)methyl 4-azidobenzoate.
What is the SMILES notation for (4-ethenylphenyl)methyl 4-azidobenzoate?
The canonical SMILES for (4-ethenylphenyl)methyl 4-azidobenzoate is C=Cc1ccc(COC(=O)c2ccc(N=[N+]=[N-])cc2)cc1.
What is the InChIKey of (4-ethenylphenyl)methyl 4-azidobenzoate?
The InChIKey is GLZIXYMSNVIWIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2/c1-2-12-3-5-13(6-4-12)11-21-16(20)14-7-9-15(10-8-14)18-19-17/h2-10H,1,11H2.
What are the key properties of (4-ethenylphenyl)methyl 4-azidobenzoate?
(4-ethenylphenyl)methyl 4-azidobenzoate has a molecular weight of 279.30 g/mol, XLogP of 4.63, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenylphenyl)methyl 4-azidobenzoate is sourced from PubChem (CID 138593704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).