C30H26O6 — CID 164789063
bis[(4-ethenylphenyl)methyl] 2,5-diacetylbenzene-1,4-dicarboxylate (PubChem CID 164789063) has the molecular formula C30H26O6 and a molecular weight of 482.53 g/mol. Its IUPAC name is bis[(4-ethenylphenyl)methyl] 2,5-diacetylbenzene-1,4-dicarboxylate.
| Compound Name | bis[(4-ethenylphenyl)methyl] 2,5-diacetylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 164789063 |
| Molecular Formula | C30H26O6 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | bis[(4-ethenylphenyl)methyl] 2,5-diacetylbenzene-1,4-dicarboxylate |
| SMILES | C=Cc1ccc(COC(=O)c2cc(C(C)=O)c(C(=O)OCc3ccc(C=C)cc3)cc2C(C)=O)cc1 |
| InChI | InChI=1S/C30H26O6/c1-5-21-7-11-23(12-8-21)17-35-29(33)27-15-26(20(4)32)28(16-25(27)19(3)31)30(34)36-18-24-13-9-22(6-2)10-14-24/h5-16H,1-2,17-18H2,3-4H3 |
| InChIKey | TZRMVLLMKNAUMW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |