(4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate

C16H14O3S — CID 172538888

IUPAC(4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate
SMILESC=Cc1ccc(COC(=O)c2ccc(C(C)=O)s2)cc1
InChIInChI=1S/C16H14O3S/c1-3-12-4-6-13(7-5-12)10-19-16(18)15-9-8-14(20-15)11(2)17/h3-9H,1,10H2,2H3
InChIKeyRIBKSNXLKABXNX-UHFFFAOYSA-N
MW286.35 g/mol
LogP3.95
Rot. Bonds5

About (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate

(4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate (PubChem CID 172538888) has the molecular formula C16H14O3S and a molecular weight of 286.35 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate.

Molecular Properties

Compound Name(4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate
PubChem CID172538888
Molecular FormulaC16H14O3S
Molecular Weight286.35 g/mol
Exact Mass286.07
IUPAC Name(4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate
SMILESC=Cc1ccc(COC(=O)c2ccc(C(C)=O)s2)cc1
InChIInChI=1S/C16H14O3S/c1-3-12-4-6-13(7-5-12)10-19-16(18)15-9-8-14(20-15)11(2)17/h3-9H,1,10H2,2H3
InChIKeyRIBKSNXLKABXNX-UHFFFAOYSA-N
XLogP3.95
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.35
LogP ≤ 53.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate?
The IUPAC name of (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate (CID 172538888) is (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate.
What is the SMILES notation for (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate?
The canonical SMILES for (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate is C=Cc1ccc(COC(=O)c2ccc(C(C)=O)s2)cc1.
What is the InChIKey of (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate?
The InChIKey is RIBKSNXLKABXNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3S/c1-3-12-4-6-13(7-5-12)10-19-16(18)15-9-8-14(20-15)11(2)17/h3-9H,1,10H2,2H3.
What are the key properties of (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate?
(4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate has a molecular weight of 286.35 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenylphenyl)methyl 5-acetylthiophene-2-carboxylate is sourced from PubChem (CID 172538888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).