C36H32O4 — CID 58520026
[4-[2-[4-(4-ethylphenyl)phenyl]-1-[4-(prop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]methyl prop-2-enoate (PubChem CID 58520026) has the molecular formula C36H32O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is [4-[2-[4-(4-ethylphenyl)phenyl]-1-[4-(prop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]methyl prop-2-enoate.
| Compound Name | [4-[2-[4-(4-ethylphenyl)phenyl]-1-[4-(prop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 58520026 |
| Molecular Formula | C36H32O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | [4-[2-[4-(4-ethylphenyl)phenyl]-1-[4-(prop-2-enoyloxymethyl)phenyl]ethenyl]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(C(=Cc2ccc(-c3ccc(CC)cc3)cc2)c2ccc(COC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C36H32O4/c1-4-26-7-15-30(16-8-26)31-17-9-27(10-18-31)23-34(32-19-11-28(12-20-32)24-39-35(37)5-2)33-21-13-29(14-22-33)25-40-36(38)6-3/h5-23H,2-4,24-25H2,1H3 |
| InChIKey | BFVUJGVUPJDZBZ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|