C11H12O2S — CID 171485836
(4-methylsulfanylphenyl)methyl prop-2-enoate (PubChem CID 171485836) has the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl prop-2-enoate.
| Compound Name | (4-methylsulfanylphenyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 171485836 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(SC)cc1 |
| InChI | InChI=1S/C11H12O2S/c1-3-11(12)13-8-9-4-6-10(14-2)7-5-9/h3-7H,1,8H2,2H3 |
| InChIKey | YPDKJWHDNPGODY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|