C16H26O3Si2 — CID 173310321
[4-[2-[methyl(trimethylsilyloxy)silyl]ethyl]phenyl]methyl prop-2-enoate (PubChem CID 173310321) has the molecular formula C16H26O3Si2 and a molecular weight of 322.55 g/mol. Its IUPAC name is [4-[2-[methyl(trimethylsilyloxy)silyl]ethyl]phenyl]methyl prop-2-enoate.
| Compound Name | [4-[2-[methyl(trimethylsilyloxy)silyl]ethyl]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 173310321 |
| Molecular Formula | C16H26O3Si2 |
| Molecular Weight | 322.55 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [4-[2-[methyl(trimethylsilyloxy)silyl]ethyl]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(CC[SiH](C)O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H26O3Si2/c1-6-16(17)18-13-15-9-7-14(8-10-15)11-12-20(2)19-21(3,4)5/h6-10,20H,1,11-13H2,2-5H3 |
| InChIKey | ORUHPHYOXDYAKX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|