C18H16O5S2 — CID 90058033
[4-[[4-(carboxyoxymethyl)phenyl]disulfanyl]phenyl]methyl prop-2-enoate (PubChem CID 90058033) has the molecular formula C18H16O5S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is [4-[[4-(carboxyoxymethyl)phenyl]disulfanyl]phenyl]methyl prop-2-enoate.
| Compound Name | [4-[[4-(carboxyoxymethyl)phenyl]disulfanyl]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 90058033 |
| Molecular Formula | C18H16O5S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | [4-[[4-(carboxyoxymethyl)phenyl]disulfanyl]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(SSc2ccc(COC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H16O5S2/c1-2-17(19)22-11-13-3-7-15(8-4-13)24-25-16-9-5-14(6-10-16)12-23-18(20)21/h2-10H,1,11-12H2,(H,20,21) |
| InChIKey | BEVRFFQHMUGDLI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|