C37H28O8 — CID 118605481
[4-[2-[3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)-4-[2-[4-(prop-2-enoyloxymethyl)phenyl]ethynyl]phenyl]ethynyl]phenyl]methyl prop-2-enoate (PubChem CID 118605481) has the molecular formula C37H28O8 and a molecular weight of 600.62 g/mol. Its IUPAC name is [4-[2-[3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)-4-[2-[4-(prop-2-enoyloxymethyl)phenyl]ethynyl]phenyl]ethynyl]phenyl]methyl prop-2-enoate.
| Compound Name | [4-[2-[3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)-4-[2-[4-(prop-2-enoyloxymethyl)phenyl]ethynyl]phenyl]ethynyl]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 118605481 |
| Molecular Formula | C37H28O8 |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | [4-[2-[3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)-4-[2-[4-(prop-2-enoyloxymethyl)phenyl]ethynyl]phenyl]ethynyl]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(C#Cc2ccc(C#Cc3ccc(COC(=O)C=C)cc3)c(OC(=O)C=C)c2COC(=O)C=C)cc1 |
| InChI | InChI=1S/C37H28O8/c1-5-33(38)42-23-28-13-9-26(10-14-28)17-19-30-21-22-31(37(45-36(41)8-4)32(30)25-44-35(40)7-3)20-18-27-11-15-29(16-12-27)24-43-34(39)6-2/h5-16,21-22H,1-4,23-25H2 |
| InChIKey | AXQALBPTAWOHCK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|