C10H7F3O2 — CID 102015327
(2,3,6-trifluorophenyl)methyl prop-2-enoate (PubChem CID 102015327) has the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. Its IUPAC name is (2,3,6-trifluorophenyl)methyl prop-2-enoate.
| Compound Name | (2,3,6-trifluorophenyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 102015327 |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (2,3,6-trifluorophenyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C10H7F3O2/c1-2-9(14)15-5-6-7(11)3-4-8(12)10(6)13/h2-4H,1,5H2 |
| InChIKey | RECFBUKGKLLKHM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|