About (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate
(2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate (PubChem CID 163588453) has the molecular formula C16H19F3O2
and a molecular weight of 300.32 g/mol. Its IUPAC name is (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate.
Molecular Properties
| Compound Name | (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate |
| PubChem CID | 163588453 |
| Molecular Formula | C16H19F3O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate |
| SMILES | O=C(CCC1CCCCC1)OCc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C16H19F3O2/c17-13-7-8-14(18)16(19)12(13)10-21-15(20)9-6-11-4-2-1-3-5-11/h7-8,11H,1-6,9-10H2 |
| InChIKey | RIKUOUPIFUPORV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate?
The IUPAC name of (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate (CID 163588453) is (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate.
What is the SMILES notation for (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate?
The canonical SMILES for (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate is O=C(CCC1CCCCC1)OCc1c(F)ccc(F)c1F.
What is the InChIKey of (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate?
The InChIKey is RIKUOUPIFUPORV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F3O2/c17-13-7-8-14(18)16(19)12(13)10-21-15(20)9-6-11-4-2-1-3-5-11/h7-8,11H,1-6,9-10H2.
What are the key properties of (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate?
(2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate has a molecular weight of 300.32 g/mol, XLogP of 4.51, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,6-trifluorophenyl)methyl 3-cyclohexylpropanoate is sourced from PubChem (CID 163588453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).