About 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate
2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate (PubChem CID 160894187) has the molecular formula C28H42O6
and a molecular weight of 474.64 g/mol. Its IUPAC name is 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate.
Molecular Properties
| Compound Name | 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate |
| PubChem CID | 160894187 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate |
| SMILES | O=C(CCC1CCCCC1)OCCOc1ccccc1OCCOC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C28H42O6/c29-27(17-15-23-9-3-1-4-10-23)33-21-19-31-25-13-7-8-14-26(25)32-20-22-34-28(30)18-16-24-11-5-2-6-12-24/h7-8,13-14,23-24H,1-6,9-12,15-22H2 |
| InChIKey | NPZZQRUPHVWUNU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate?
The IUPAC name of 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate (CID 160894187) is 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate.
What is the SMILES notation for 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate?
The canonical SMILES for 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate is O=C(CCC1CCCCC1)OCCOc1ccccc1OCCOC(=O)CCC1CCCCC1.
What is the InChIKey of 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate?
The InChIKey is NPZZQRUPHVWUNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H42O6/c29-27(17-15-23-9-3-1-4-10-23)33-21-19-31-25-13-7-8-14-26(25)32-20-22-34-28(30)18-16-24-11-5-2-6-12-24/h7-8,13-14,23-24H,1-6,9-12,15-22H2.
What are the key properties of 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate?
2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate has a molecular weight of 474.64 g/mol, XLogP of 6.25, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(3-cyclohexylpropanoyloxy)ethoxy]phenoxy]ethyl 3-cyclohexylpropanoate is sourced from PubChem (CID 160894187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).