C17H21NO2S — CID 2397721
1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate (PubChem CID 2397721) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 2397721 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate |
| SMILES | O=C(CCC1CCCCC1)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H21NO2S/c19-17(11-10-13-6-2-1-3-7-13)20-12-16-18-14-8-4-5-9-15(14)21-16/h4-5,8-9,13H,1-3,6-7,10-12H2 |
| InChIKey | QGAKPNGKLDOJDG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |