1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate

C17H21NO2S — CID 2397721

IUPAC1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate
SMILESO=C(CCC1CCCCC1)OCc1nc2ccccc2s1
InChIInChI=1S/C17H21NO2S/c19-17(11-10-13-6-2-1-3-7-13)20-12-16-18-14-8-4-5-9-15(14)21-16/h4-5,8-9,13H,1-3,6-7,10-12H2
InChIKeyQGAKPNGKLDOJDG-UHFFFAOYSA-N
MW303.43 g/mol
LogP4.70
Rot. Bonds5

About 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate

1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate (PubChem CID 2397721) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate.

Molecular Properties

Compound Name1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate
PubChem CID2397721
Molecular FormulaC17H21NO2S
Molecular Weight303.43 g/mol
Exact Mass303.13
IUPAC Name1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate
SMILESO=C(CCC1CCCCC1)OCc1nc2ccccc2s1
InChIInChI=1S/C17H21NO2S/c19-17(11-10-13-6-2-1-3-7-13)20-12-16-18-14-8-4-5-9-15(14)21-16/h4-5,8-9,13H,1-3,6-7,10-12H2
InChIKeyQGAKPNGKLDOJDG-UHFFFAOYSA-N
XLogP4.70
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.43
LogP ≤ 54.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate?
The IUPAC name of 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate (CID 2397721) is 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate.
What is the SMILES notation for 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate?
The canonical SMILES for 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate is O=C(CCC1CCCCC1)OCc1nc2ccccc2s1.
What is the InChIKey of 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate?
The InChIKey is QGAKPNGKLDOJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO2S/c19-17(11-10-13-6-2-1-3-7-13)20-12-16-18-14-8-4-5-9-15(14)21-16/h4-5,8-9,13H,1-3,6-7,10-12H2.
What are the key properties of 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate?
1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate has a molecular weight of 303.43 g/mol, XLogP of 4.70, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylmethyl 3-cyclohexylpropanoate is sourced from PubChem (CID 2397721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).