C13H13NO2S — CID 78760113
1,3-benzothiazol-2-ylmethyl cyclobutanecarboxylate (PubChem CID 78760113) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl cyclobutanecarboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl cyclobutanecarboxylate |
|---|---|
| PubChem CID | 78760113 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl cyclobutanecarboxylate |
| SMILES | O=C(OCc1nc2ccccc2s1)C1CCC1 |
| InChI | InChI=1S/C13H13NO2S/c15-13(9-4-3-5-9)16-8-12-14-10-6-1-2-7-11(10)17-12/h1-2,6-7,9H,3-5,8H2 |
| InChIKey | REXCPXIIFHSZRY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |