C17H15F3N2O3S — CID 5145083
1,3-benzothiazol-2-ylmethyl 1-(4,4,4-trifluoro-3-oxobut-1-enyl)pyrrolidine-2-carboxylate (PubChem CID 5145083) has the molecular formula C17H15F3N2O3S and a molecular weight of 384.38 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 1-(4,4,4-trifluoro-3-oxobut-1-enyl)pyrrolidine-2-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 1-(4,4,4-trifluoro-3-oxobut-1-enyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 5145083 |
| Molecular Formula | C17H15F3N2O3S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 1-(4,4,4-trifluoro-3-oxobut-1-enyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2s1)C1CCCN1C=CC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H15F3N2O3S/c18-17(19,20)14(23)7-9-22-8-3-5-12(22)16(24)25-10-15-21-11-4-1-2-6-13(11)26-15/h1-2,4,6-7,9,12H,3,5,8,10H2 |
| InChIKey | FACZTEGAGQEXCN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|