C21H25F3N2O4 — CID 3296317
[2-(2,6-diethylanilino)-2-oxoethyl] 1-(4,4,4-trifluoro-3-oxobut-1-enyl)pyrrolidine-2-carboxylate (PubChem CID 3296317) has the molecular formula C21H25F3N2O4 and a molecular weight of 426.44 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 1-(4,4,4-trifluoro-3-oxobut-1-enyl)pyrrolidine-2-carboxylate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 1-(4,4,4-trifluoro-3-oxobut-1-enyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 3296317 |
| Molecular Formula | C21H25F3N2O4 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 1-(4,4,4-trifluoro-3-oxobut-1-enyl)pyrrolidine-2-carboxylate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)C1CCCN1C=CC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H25F3N2O4/c1-3-14-7-5-8-15(4-2)19(14)25-18(28)13-30-20(29)16-9-6-11-26(16)12-10-17(27)21(22,23)24/h5,7-8,10,12,16H,3-4,6,9,11,13H2,1-2H3,(H,25,28) |
| InChIKey | ILHAFEDGZVFLQF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|