C17H15F4N3O6 — CID 2456902
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (2R)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxylate (PubChem CID 2456902) has the molecular formula C17H15F4N3O6 and a molecular weight of 433.31 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (2R)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxylate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (2R)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 2456902 |
| Molecular Formula | C17H15F4N3O6 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (2R)-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxylate |
| SMILES | O=C(COC(=O)[C@H]1CCCN1/C=C/C(=O)C(F)(F)F)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C17H15F4N3O6/c18-11-4-3-10(24(28)29)8-12(11)22-15(26)9-30-16(27)13-2-1-6-23(13)7-5-14(25)17(19,20)21/h3-5,7-8,13H,1-2,6,9H2,(H,22,26)/b7-5+/t13-/m1/s1 |
| InChIKey | DHLWFLJSSZEUTQ-VUDGCMKMSA-N |
| XLogP | 2.33 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|