C17H23N3O7S — CID 42921045
[2-(2-methyl-5-nitroanilino)-2-oxoethyl] 1-propylsulfonylpyrrolidine-2-carboxylate (PubChem CID 42921045) has the molecular formula C17H23N3O7S and a molecular weight of 413.45 g/mol. Its IUPAC name is [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 1-propylsulfonylpyrrolidine-2-carboxylate.
| Compound Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 1-propylsulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 42921045 |
| Molecular Formula | C17H23N3O7S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 1-propylsulfonylpyrrolidine-2-carboxylate |
| SMILES | CCCS(=O)(=O)N1CCCC1C(=O)OCC(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C17H23N3O7S/c1-3-9-28(25,26)19-8-4-5-15(19)17(22)27-11-16(21)18-14-10-13(20(23)24)7-6-12(14)2/h6-7,10,15H,3-5,8-9,11H2,1-2H3,(H,18,21) |
| InChIKey | BHKCNDGXADTCOU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|