C23H26N2O6S — CID 55442537
[2-(2-benzoylanilino)-2-oxoethyl] 1-propylsulfonylpyrrolidine-2-carboxylate (PubChem CID 55442537) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is [2-(2-benzoylanilino)-2-oxoethyl] 1-propylsulfonylpyrrolidine-2-carboxylate.
| Compound Name | [2-(2-benzoylanilino)-2-oxoethyl] 1-propylsulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55442537 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [2-(2-benzoylanilino)-2-oxoethyl] 1-propylsulfonylpyrrolidine-2-carboxylate |
| SMILES | CCCS(=O)(=O)N1CCCC1C(=O)OCC(=O)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O6S/c1-2-15-32(29,30)25-14-8-13-20(25)23(28)31-16-21(26)24-19-12-7-6-11-18(19)22(27)17-9-4-3-5-10-17/h3-7,9-12,20H,2,8,13-16H2,1H3,(H,24,26) |
| InChIKey | FGDRNRZOPSWEIB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |