C14H19N3O6S — CID 75392222
N-(2-hydroxy-5-nitrophenyl)-1-propylsulfonylpyrrolidine-2-carboxamide (PubChem CID 75392222) has the molecular formula C14H19N3O6S and a molecular weight of 357.39 g/mol. Its IUPAC name is N-(2-hydroxy-5-nitrophenyl)-1-propylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(2-hydroxy-5-nitrophenyl)-1-propylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 75392222 |
| Molecular Formula | C14H19N3O6S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-(2-hydroxy-5-nitrophenyl)-1-propylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCCC1C(=O)Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C14H19N3O6S/c1-2-8-24(22,23)16-7-3-4-12(16)14(19)15-11-9-10(17(20)21)5-6-13(11)18/h5-6,9,12,18H,2-4,7-8H2,1H3,(H,15,19) |
| InChIKey | VTGRBAPWGLHLDL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|