C20H23N3O8S — CID 108789867
1-(3,4-dimethoxyphenyl)sulfonyl-N-(2-methoxy-5-nitrophenyl)pyrrolidine-2-carboxamide (PubChem CID 108789867) has the molecular formula C20H23N3O8S and a molecular weight of 465.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-N-(2-methoxy-5-nitrophenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-N-(2-methoxy-5-nitrophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 108789867 |
| Molecular Formula | C20H23N3O8S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-N-(2-methoxy-5-nitrophenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C1CCCN1S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H23N3O8S/c1-29-17-8-6-13(23(25)26)11-15(17)21-20(24)16-5-4-10-22(16)32(27,28)14-7-9-18(30-2)19(12-14)31-3/h6-9,11-12,16H,4-5,10H2,1-3H3,(H,21,24) |
| InChIKey | SCSZQJVXZFXFHV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|