C18H17N5O6S2 — CID 92665117
(2S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-methoxy-5-nitrophenyl)pyrrolidine-2-carboxamide (PubChem CID 92665117) has the molecular formula C18H17N5O6S2 and a molecular weight of 463.50 g/mol. Its IUPAC name is (2S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-methoxy-5-nitrophenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-methoxy-5-nitrophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 92665117 |
| Molecular Formula | C18H17N5O6S2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | (2S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-methoxy-5-nitrophenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1CCCN1S(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C18H17N5O6S2/c1-29-15-8-7-11(23(25)26)10-13(15)19-18(24)14-5-3-9-22(14)31(27,28)16-6-2-4-12-17(16)21-30-20-12/h2,4,6-8,10,14H,3,5,9H2,1H3,(H,19,24)/t14-/m0/s1 |
| InChIKey | DPZHOXBVVRRWCX-AWEZNQCLSA-N |
| XLogP | 2.40 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|