C19H26N4O3S2 — CID 20862233
1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-cyclooctylpyrrolidine-2-carboxamide (PubChem CID 20862233) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-cyclooctylpyrrolidine-2-carboxamide.
| Compound Name | 1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-cyclooctylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 20862233 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-cyclooctylpyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)C1CCCN1S(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C19H26N4O3S2/c24-19(20-14-8-4-2-1-3-5-9-14)16-11-7-13-23(16)28(25,26)17-12-6-10-15-18(17)22-27-21-15/h6,10,12,14,16H,1-5,7-9,11,13H2,(H,20,24) |
| InChIKey | ITEBXKNUIMUWML-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |