C19H27N5O3S2 — CID 46673780
4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-cyclooctylpiperazine-1-carboxamide (PubChem CID 46673780) has the molecular formula C19H27N5O3S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-cyclooctylpiperazine-1-carboxamide.
| Compound Name | 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-cyclooctylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 46673780 |
| Molecular Formula | C19H27N5O3S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-cyclooctylpiperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)N1CCN(S(=O)(=O)c2cccc3nsnc23)CC1 |
| InChI | InChI=1S/C19H27N5O3S2/c25-19(20-15-7-4-2-1-3-5-8-15)23-11-13-24(14-12-23)29(26,27)17-10-6-9-16-18(17)22-28-21-16/h6,9-10,15H,1-5,7-8,11-14H2,(H,20,25) |
| InChIKey | FNGWYGMGQBVUJH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |