C18H22N4O3S2 — CID 60573623
1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-2-cyclohexylideneethanone (PubChem CID 60573623) has the molecular formula C18H22N4O3S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-2-cyclohexylideneethanone.
| Compound Name | 1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-2-cyclohexylideneethanone |
|---|---|
| PubChem CID | 60573623 |
| Molecular Formula | C18H22N4O3S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-[4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazin-1-yl]-2-cyclohexylideneethanone |
| SMILES | O=C(C=C1CCCCC1)N1CCN(S(=O)(=O)c2cccc3nsnc23)CC1 |
| InChI | InChI=1S/C18H22N4O3S2/c23-17(13-14-5-2-1-3-6-14)21-9-11-22(12-10-21)27(24,25)16-8-4-7-15-18(16)20-26-19-15/h4,7-8,13H,1-3,5-6,9-12H2 |
| InChIKey | QLVRDWUYJXBOAX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|